C12H15BrN2O2S — CID 107027224
2-bromo-N-[3-(dimethylamino)-3-oxopropyl]-5-sulfanylbenzamide (PubChem CID 107027224) has the molecular formula C12H15BrN2O2S and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-bromo-N-[3-(dimethylamino)-3-oxopropyl]-5-sulfanylbenzamide.
| Compound Name | 2-bromo-N-[3-(dimethylamino)-3-oxopropyl]-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107027224 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-bromo-N-[3-(dimethylamino)-3-oxopropyl]-5-sulfanylbenzamide |
| SMILES | CN(C)C(=O)CCNC(=O)c1cc(S)ccc1Br |
| InChI | InChI=1S/C12H15BrN2O2S/c1-15(2)11(16)5-6-14-12(17)9-7-8(18)3-4-10(9)13/h3-4,7,18H,5-6H2,1-2H3,(H,14,17) |
| InChIKey | CCQMHBKHXFDRQJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|