C15H19BrN2O2S — CID 107034736
2-bromo-N-(3-oxo-3-piperidin-1-ylpropyl)-5-sulfanylbenzamide (PubChem CID 107034736) has the molecular formula C15H19BrN2O2S and a molecular weight of 371.30 g/mol. Its IUPAC name is 2-bromo-N-(3-oxo-3-piperidin-1-ylpropyl)-5-sulfanylbenzamide.
| Compound Name | 2-bromo-N-(3-oxo-3-piperidin-1-ylpropyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107034736 |
| Molecular Formula | C15H19BrN2O2S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-bromo-N-(3-oxo-3-piperidin-1-ylpropyl)-5-sulfanylbenzamide |
| SMILES | O=C(NCCC(=O)N1CCCCC1)c1cc(S)ccc1Br |
| InChI | InChI=1S/C15H19BrN2O2S/c16-13-5-4-11(21)10-12(13)15(20)17-7-6-14(19)18-8-2-1-3-9-18/h4-5,10,21H,1-3,6-9H2,(H,17,20) |
| InChIKey | RCGYJLHTAAPBID-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|