C21H26N2O3 — CID 110832360
(E)-N'-(4-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylbut-2-enediamide (PubChem CID 110832360) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (E)-N'-(4-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylbut-2-enediamide.
| Compound Name | (E)-N'-(4-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylbut-2-enediamide |
|---|---|
| PubChem CID | 110832360 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (E)-N'-(4-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylbut-2-enediamide |
| SMILES | CC(=O)c1ccc(NC(=O)/C=C(\C)C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-15(21(26)22-13-12-17-6-4-3-5-7-17)14-20(25)23-19-10-8-18(9-11-19)16(2)24/h6,8-11,14H,3-5,7,12-13H2,1-2H3,(H,22,26)(H,23,25)/b15-14+ |
| InChIKey | RVGBPVBOFXCIRU-CCEZHUSRSA-N |
| XLogP | 3.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|