C22H31N3O2 — CID 108984207
N-[2-(cyclohexen-1-yl)ethyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]oxamide (PubChem CID 108984207) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 108984207 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[4-(4-methylpiperidin-1-yl)phenyl]oxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)C(=O)NCCC3=CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H31N3O2/c1-17-12-15-25(16-13-17)20-9-7-19(8-10-20)24-22(27)21(26)23-14-11-18-5-3-2-4-6-18/h5,7-10,17H,2-4,6,11-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | FCERWJXSBXPUCL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|