C24H37N5O — CID 50771431
N-[2-(cyclohexen-1-yl)ethyl]-1-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 50771431) has the molecular formula C24H37N5O and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50771431 |
| Molecular Formula | C24H37N5O |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | CC1CCN(c2ccc(N3CCC(C(=O)NCCC4=CCCCC4)CC3)nn2)CC1 |
| InChI | InChI=1S/C24H37N5O/c1-19-10-15-28(16-11-19)22-7-8-23(27-26-22)29-17-12-21(13-18-29)24(30)25-14-9-20-5-3-2-4-6-20/h5,7-8,19,21H,2-4,6,9-18H2,1H3,(H,25,30) |
| InChIKey | YAKOQYONWXCERB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|