C23H29N3O2 — CID 108986246
N'-[4-(4-methylpiperidin-1-yl)phenyl]-N-(3-phenylpropyl)oxamide (PubChem CID 108986246) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N'-[4-(4-methylpiperidin-1-yl)phenyl]-N-(3-phenylpropyl)oxamide.
| Compound Name | N'-[4-(4-methylpiperidin-1-yl)phenyl]-N-(3-phenylpropyl)oxamide |
|---|---|
| PubChem CID | 108986246 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N'-[4-(4-methylpiperidin-1-yl)phenyl]-N-(3-phenylpropyl)oxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)C(=O)NCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H29N3O2/c1-18-13-16-26(17-14-18)21-11-9-20(10-12-21)25-23(28)22(27)24-15-5-8-19-6-3-2-4-7-19/h2-4,6-7,9-12,18H,5,8,13-17H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | OXXFAXHVWVKIEP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|