C27H29N3O2 — CID 16891728
N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-methylphenyl)oxamide (PubChem CID 16891728) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-methylphenyl)oxamide.
| Compound Name | N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 16891728 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCCCc2ccc(N3CCc4ccccc4C3)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-20-8-12-24(13-9-20)29-27(32)26(31)28-17-4-5-21-10-14-25(15-11-21)30-18-16-22-6-2-3-7-23(22)19-30/h2-3,6-15H,4-5,16-19H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | OXARPQNIXLYSFL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|