C26H25ClFN3O2 — CID 16891754
N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]oxamide (PubChem CID 16891754) has the molecular formula C26H25ClFN3O2 and a molecular weight of 465.96 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]oxamide |
|---|---|
| PubChem CID | 16891754 |
| Molecular Formula | C26H25ClFN3O2 |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]oxamide |
| SMILES | O=C(NCCCc1ccc(N2CCc3ccccc3C2)cc1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C26H25ClFN3O2/c27-23-16-21(9-12-24(23)28)30-26(33)25(32)29-14-3-4-18-7-10-22(11-8-18)31-15-13-19-5-1-2-6-20(19)17-31/h1-2,5-12,16H,3-4,13-15,17H2,(H,29,32)(H,30,33) |
| InChIKey | VDUKJMOIPOPAFY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|