C28H31N3O2 — CID 16891766
N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-ethylphenyl)oxamide (PubChem CID 16891766) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-ethylphenyl)oxamide.
| Compound Name | N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 16891766 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-N'-(4-ethylphenyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NCCCc2ccc(N3CCc4ccccc4C3)cc2)cc1 |
| InChI | InChI=1S/C28H31N3O2/c1-2-21-9-13-25(14-10-21)30-28(33)27(32)29-18-5-6-22-11-15-26(16-12-22)31-19-17-23-7-3-4-8-24(23)20-31/h3-4,7-16H,2,5-6,17-20H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | NESIEICGMVHYKH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|