C25H24FN3O2 — CID 16891248
N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N'-(4-fluorophenyl)oxamide (PubChem CID 16891248) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N'-(4-fluorophenyl)oxamide.
| Compound Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N'-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 16891248 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N'-(4-fluorophenyl)oxamide |
| SMILES | O=C(NCCc1ccc(N2CCc3ccccc3C2)cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FN3O2/c26-21-7-9-22(10-8-21)28-25(31)24(30)27-15-13-18-5-11-23(12-6-18)29-16-14-19-3-1-2-4-20(19)17-29/h1-12H,13-17H2,(H,27,30)(H,28,31) |
| InChIKey | FBUJKDCUIWTTQO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|