C22H27N3O2 — CID 16891220
N'-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N-propyloxamide (PubChem CID 16891220) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N'-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N-propyloxamide.
| Compound Name | N'-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N-propyloxamide |
|---|---|
| PubChem CID | 16891220 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N'-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NCCc1ccc(N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-2-13-23-21(26)22(27)24-14-11-17-7-9-20(10-8-17)25-15-12-18-5-3-4-6-19(18)16-25/h3-10H,2,11-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | BQFZVLBMTGXRCG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|