C27H30N2O3 — CID 16889197
N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 16889197) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16889197 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCc2ccc(N3CCc4ccccc4C3)cc2)cc1OC |
| InChI | InChI=1S/C27H30N2O3/c1-31-25-12-9-21(17-26(25)32-2)18-27(30)28-15-13-20-7-10-24(11-8-20)29-16-14-22-5-3-4-6-23(22)19-29/h3-12,17H,13-16,18-19H2,1-2H3,(H,28,30) |
| InChIKey | SZNAXXWEQLRFIX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|