C27H30N2O4 — CID 16889165
N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 16889165) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16889165 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCc2ccc(N3CCc4ccccc4C3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H30N2O4/c1-31-24-16-22(17-25(32-2)26(24)33-3)27(30)28-14-12-19-8-10-23(11-9-19)29-15-13-20-6-4-5-7-21(20)18-29/h4-11,16-17H,12-15,18H2,1-3H3,(H,28,30) |
| InChIKey | DJJMTFPSCKMMFV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|