C23H21FN2O3 — CID 155620473
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide (PubChem CID 155620473) has the molecular formula C23H21FN2O3 and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 155620473 |
| Molecular Formula | C23H21FN2O3 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCc4ccccc4C3)cc2)cc(F)c1O |
| InChI | InChI=1S/C23H21FN2O3/c1-29-21-13-17(12-20(24)22(21)27)23(28)25-18-6-8-19(9-7-18)26-11-10-15-4-2-3-5-16(15)14-26/h2-9,12-13,27H,10-11,14H2,1H3,(H,25,28) |
| InChIKey | RXSJLDAHOABWFY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|