C21H23FN2O3 — CID 155620427
N-[4-(8-azabicyclo[3.2.1]octan-8-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide (PubChem CID 155620427) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[4-(8-azabicyclo[3.2.1]octan-8-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide.
| Compound Name | N-[4-(8-azabicyclo[3.2.1]octan-8-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 155620427 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[4-(8-azabicyclo[3.2.1]octan-8-yl)phenyl]-3-fluoro-4-hydroxy-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3C4CCCC3CC4)cc2)cc(F)c1O |
| InChI | InChI=1S/C21H23FN2O3/c1-27-19-12-13(11-18(22)20(19)25)21(26)23-14-5-7-17(8-6-14)24-15-3-2-4-16(24)10-9-15/h5-8,11-12,15-16,25H,2-4,9-10H2,1H3,(H,23,26) |
| InChIKey | CBPMDYGJRIGUHJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |