C24H30N2O5 — CID 2973116
N-[4-(2,6-dimethylpiperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 2973116) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[4-(2,6-dimethylpiperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(2,6-dimethylpiperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2973116 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[4-(2,6-dimethylpiperidine-1-carbonyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)N3C(C)CCCC3C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N2O5/c1-15-7-6-8-16(2)26(15)24(28)17-9-11-19(12-10-17)25-23(27)18-13-20(29-3)22(31-5)21(14-18)30-4/h9-16H,6-8H2,1-5H3,(H,25,27) |
| InChIKey | KPBWXBSOBVVWTG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |