C16H23NO5 — CID 110292317
(3,5-dimethylmorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 110292317) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is (3,5-dimethylmorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (3,5-dimethylmorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 110292317 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (3,5-dimethylmorpholin-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2C(C)COCC2C)cc(OC)c1OC |
| InChI | InChI=1S/C16H23NO5/c1-10-8-22-9-11(2)17(10)16(18)12-6-13(19-3)15(21-5)14(7-12)20-4/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | WVXGAUYYTQBTQJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |