C11H13NO4S — CID 142936854
thiaziridin-2-yl-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 142936854) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is thiaziridin-2-yl-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | thiaziridin-2-yl-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 142936854 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | thiaziridin-2-yl-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CS2)cc(OC)c1OC |
| InChI | InChI=1S/C11H13NO4S/c1-14-8-4-7(11(13)12-6-17-12)5-9(15-2)10(8)16-3/h4-5H,6H2,1-3H3 |
| InChIKey | FWOZHQIMOSVYGV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|