C14H17NO6S — CID 53215677
(4R)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 53215677) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is (4R)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53215677 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (4R)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1cc(C(=O)N2CSC[C@H]2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C14H17NO6S/c1-19-10-4-8(5-11(20-2)12(10)21-3)13(16)15-7-22-6-9(15)14(17)18/h4-5,9H,6-7H2,1-3H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | USEHRHAZLPMADG-VIFPVBQESA-N |
| XLogP | 1.31 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |