C17H24N2O6S — CID 42744384
N-(2-methoxyethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744384) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744384 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(2-methoxyethyl)-3-(3,4,5-trimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | COCCNC(=O)C1CSCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H24N2O6S/c1-22-6-5-18-16(20)12-9-26-10-19(12)17(21)11-7-13(23-2)15(25-4)14(8-11)24-3/h7-8,12H,5-6,9-10H2,1-4H3,(H,18,20) |
| InChIKey | KBAJNNKYDCMUSM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|