C33H48N2O5S — CID 42745740
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,5-dimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42745740) has the molecular formula C33H48N2O5S and a molecular weight of 584.82 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,5-dimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,5-dimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42745740 |
| Molecular Formula | C33H48N2O5S |
| Molecular Weight | 584.82 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,5-dimethoxybenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)C2CSCN2C(=O)c2cc(OC)cc(OC)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C33H48N2O5S/c1-9-32(3,4)24-13-14-29(27(19-24)33(5,6)10-2)40-16-12-11-15-34-30(36)28-21-41-22-35(28)31(37)23-17-25(38-7)20-26(18-23)39-8/h13-14,17-20,28H,9-12,15-16,21-22H2,1-8H3,(H,34,36) |
| InChIKey | UVIOLMSYLONGEY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.82 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|