C19H30ClN3O2S — CID 119506268
3-(4-tert-butylbenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119506268) has the molecular formula C19H30ClN3O2S and a molecular weight of 399.99 g/mol. Its IUPAC name is 3-(4-tert-butylbenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | 3-(4-tert-butylbenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119506268 |
| Molecular Formula | C19H30ClN3O2S |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-(4-tert-butylbenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)C1CSCN1C(=O)c1ccc(C(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C19H29N3O2S.ClH/c1-5-20-10-11-21-17(23)16-12-25-13-22(16)18(24)14-6-8-15(9-7-14)19(2,3)4;/h6-9,16,20H,5,10-13H2,1-4H3,(H,21,23);1H |
| InChIKey | VIAGELGRKLNIOB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|