C15H21Cl2N3O2S — CID 119507547
3-(4-chlorobenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119507547) has the molecular formula C15H21Cl2N3O2S and a molecular weight of 378.33 g/mol. Its IUPAC name is 3-(4-chlorobenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | 3-(4-chlorobenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119507547 |
| Molecular Formula | C15H21Cl2N3O2S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-(4-chlorobenzoyl)-N-[2-(ethylamino)ethyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)C1CSCN1C(=O)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C15H20ClN3O2S.ClH/c1-2-17-7-8-18-14(20)13-9-22-10-19(13)15(21)11-3-5-12(16)6-4-11;/h3-6,13,17H,2,7-10H2,1H3,(H,18,20);1H |
| InChIKey | IMJRXSHBDVSDEX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|