C35H51FN2O3S — CID 3670213
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 3670213) has the molecular formula C35H51FN2O3S and a molecular weight of 598.87 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 3670213 |
| Molecular Formula | C35H51FN2O3S |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(2-fluorobenzoyl)-2-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)C2CSC(CC(C)C)N2C(=O)c2ccccc2F)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H51FN2O3S/c1-9-34(5,6)25-17-18-30(27(22-25)35(7,8)10-2)41-20-14-13-19-37-32(39)29-23-42-31(21-24(3)4)38(29)33(40)26-15-11-12-16-28(26)36/h11-12,15-18,22,24,29,31H,9-10,13-14,19-21,23H2,1-8H3,(H,37,39) |
| InChIKey | ZXRWDGDWQXAYKB-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|