C25H36N2O2S — CID 2356722
4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(thiophen-2-ylmethylideneamino)butanamide (PubChem CID 2356722) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(thiophen-2-ylmethylideneamino)butanamide.
| Compound Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(thiophen-2-ylmethylideneamino)butanamide |
|---|---|
| PubChem CID | 2356722 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(thiophen-2-ylmethylideneamino)butanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)NN=Cc2cccs2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C25H36N2O2S/c1-7-24(3,4)19-13-14-22(21(17-19)25(5,6)8-2)29-15-9-12-23(28)27-26-18-20-11-10-16-30-20/h10-11,13-14,16-18H,7-9,12,15H2,1-6H3,(H,27,28) |
| InChIKey | LIESKPIRJGAQML-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|