C29H41N3O3 — CID 4098330
N-[(4-acetamidophenyl)methylideneamino]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide (PubChem CID 4098330) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)methylideneamino]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide.
| Compound Name | N-[(4-acetamidophenyl)methylideneamino]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 4098330 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | N-[(4-acetamidophenyl)methylideneamino]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)NN=Cc2ccc(NC(C)=O)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C29H41N3O3/c1-8-28(4,5)23-14-17-26(25(19-23)29(6,7)9-2)35-18-10-11-27(34)32-30-20-22-12-15-24(16-13-22)31-21(3)33/h12-17,19-20H,8-11,18H2,1-7H3,(H,31,33)(H,32,34) |
| InChIKey | QPOHSNCMNZQEKP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|