C38H45N3O6S — CID 12525045
(4E)-4-(4-acetamidophenyl)sulfonylimino-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-oxonaphthalene-2-carboxamide (PubChem CID 12525045) has the molecular formula C38H45N3O6S and a molecular weight of 671.86 g/mol. Its IUPAC name is (4E)-4-(4-acetamidophenyl)sulfonylimino-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-oxonaphthalene-2-carboxamide.
| Compound Name | (4E)-4-(4-acetamidophenyl)sulfonylimino-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-oxonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 12525045 |
| Molecular Formula | C38H45N3O6S |
| Molecular Weight | 671.86 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | (4E)-4-(4-acetamidophenyl)sulfonylimino-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-oxonaphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)C2=C/C(=N\S(=O)(=O)c3ccc(NC(C)=O)cc3)c3ccccc3C2=O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C38H45N3O6S/c1-8-37(4,5)26-15-20-34(32(23-26)38(6,7)9-2)47-22-12-21-39-36(44)31-24-33(29-13-10-11-14-30(29)35(31)43)41-48(45,46)28-18-16-27(17-19-28)40-25(3)42/h10-11,13-20,23-24H,8-9,12,21-22H2,1-7H3,(H,39,44)(H,40,42)/b41-33+ |
| InChIKey | INQMLUFSUFKRME-ZSJGZSGZSA-N |
| XLogP | 6.91 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|