C48H52N4Na2O12S2 — CID 173453133
CID 173453133 (PubChem CID 173453133) has the molecular formula C48H52N4Na2O12S2 and a molecular weight of 987.07 g/mol.
| Compound Name | CID 173453133 |
|---|---|
| PubChem CID | 173453133 |
| Molecular Formula | C48H52N4Na2O12S2 |
| Molecular Weight | 987.07 g/mol |
| Exact Mass | 986.28 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(OC(=O)Nc3ccc(/N=N/c4c(O)c(S(=O)(=O)O)cc5cc(S(=O)(=O)O)ccc45)cc3)c3ccccc3c2O)c(C(C)(C)CC)c1.[Na].[Na] |
| InChI | InChI=1S/C48H52N4O12S2.2Na/c1-7-47(3,4)30-15-22-39(38(27-30)48(5,6)8-2)63-24-12-11-23-49-45(55)37-28-40(35-13-9-10-14-36(35)43(37)53)64-46(56)50-31-16-18-32(19-17-31)51-52-42-34-21-20-33(65(57,58)59)25-29(34)26-41(44(42)54)66(60,61)62;;/h9-10,13-22,25-28,53-54H,7-8,11-12,23-24H2,1-6H3,(H,49,55)(H,50,56)(H,57,58,59)(H,60,61,62);;/b52-51+;; |
| InChIKey | PDFVJCNSOVWEBL-CWYBRPEOSA-N |
| XLogP | 10.13 |
| TPSA | 250.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.07 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|