C39H48N2O9S — CID 21412885
[3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-4-hydroxynaphthalen-1-yl] 3-(4-nitrophenoxy)propane-1-sulfonate (PubChem CID 21412885) has the molecular formula C39H48N2O9S and a molecular weight of 720.89 g/mol. Its IUPAC name is [3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-4-hydroxynaphthalen-1-yl] 3-(4-nitrophenoxy)propane-1-sulfonate.
| Compound Name | [3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-4-hydroxynaphthalen-1-yl] 3-(4-nitrophenoxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 21412885 |
| Molecular Formula | C39H48N2O9S |
| Molecular Weight | 720.89 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | [3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-4-hydroxynaphthalen-1-yl] 3-(4-nitrophenoxy)propane-1-sulfonate |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2cc(OS(=O)(=O)CCCOc3ccc([N+](=O)[O-])cc3)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C39H48N2O9S/c1-7-38(3,4)27-15-20-34(33(25-27)39(5,6)8-2)49-22-11-21-40-37(43)32-26-35(30-13-9-10-14-31(30)36(32)42)50-51(46,47)24-12-23-48-29-18-16-28(17-19-29)41(44)45/h9-10,13-20,25-26,42H,7-8,11-12,21-24H2,1-6H3,(H,40,43) |
| InChIKey | FIADDQBWFZHXQE-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.89 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|