C37H53NO8S2 — CID 20528643
4-[2,3-bis(1-hydroxyethylsulfinyl)propoxy]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-hydroxynaphthalene-2-carboxamide (PubChem CID 20528643) has the molecular formula C37H53NO8S2 and a molecular weight of 703.96 g/mol. Its IUPAC name is 4-[2,3-bis(1-hydroxyethylsulfinyl)propoxy]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | 4-[2,3-bis(1-hydroxyethylsulfinyl)propoxy]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 20528643 |
| Molecular Formula | C37H53NO8S2 |
| Molecular Weight | 703.96 g/mol |
| Exact Mass | 703.32 |
| IUPAC Name | 4-[2,3-bis(1-hydroxyethylsulfinyl)propoxy]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-1-hydroxynaphthalene-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2cc(OCC(CS(=O)C(C)O)S(=O)C(C)O)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C37H53NO8S2/c1-9-36(5,6)26-16-17-32(31(20-26)37(7,8)10-2)45-19-13-18-38-35(42)30-21-33(28-14-11-12-15-29(28)34(30)41)46-22-27(48(44)25(4)40)23-47(43)24(3)39/h11-12,14-17,20-21,24-25,27,39-41H,9-10,13,18-19,22-23H2,1-8H3,(H,38,42) |
| InChIKey | XPUXFFXEQFJUFX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|