C35H48N2O5 — CID 18731365
2-methylpropyl N-[6-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-5-hydroxynaphthalen-1-yl]carbamate (PubChem CID 18731365) has the molecular formula C35H48N2O5 and a molecular weight of 576.78 g/mol. Its IUPAC name is 2-methylpropyl N-[6-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-5-hydroxynaphthalen-1-yl]carbamate.
| Compound Name | 2-methylpropyl N-[6-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-5-hydroxynaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 18731365 |
| Molecular Formula | C35H48N2O5 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | 2-methylpropyl N-[6-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]-5-hydroxynaphthalen-1-yl]carbamate |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2ccc3c(NC(=O)OCC(C)C)cccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H48N2O5/c1-9-34(5,6)24-15-18-30(28(21-24)35(7,8)10-2)41-20-12-19-36-32(39)27-17-16-25-26(31(27)38)13-11-14-29(25)37-33(40)42-22-23(3)4/h11,13-18,21,23,38H,9-10,12,19-20,22H2,1-8H3,(H,36,39)(H,37,40) |
| InChIKey | CTVXKQSEDRWIQJ-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|