C30H34N2O5 — CID 22085882
3-[[5-hydroxy-6-[4-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]naphthalen-1-yl]amino]prop-2-ynoic acid (PubChem CID 22085882) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is 3-[[5-hydroxy-6-[4-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]naphthalen-1-yl]amino]prop-2-ynoic acid.
| Compound Name | 3-[[5-hydroxy-6-[4-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]naphthalen-1-yl]amino]prop-2-ynoic acid |
|---|---|
| PubChem CID | 22085882 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 3-[[5-hydroxy-6-[4-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]naphthalen-1-yl]amino]prop-2-ynoic acid |
| SMILES | CCC(C)(C)c1cc(C)ccc1OCCCCNC(=O)c1ccc2c(NC#CC(=O)O)cccc2c1O |
| InChI | InChI=1S/C30H34N2O5/c1-5-30(3,4)24-19-20(2)11-14-26(24)37-18-7-6-16-32-29(36)23-13-12-21-22(28(23)35)9-8-10-25(21)31-17-15-27(33)34/h8-14,19,31,35H,5-7,16,18H2,1-4H3,(H,32,36)(H,33,34) |
| InChIKey | UFLWPFSHYDCZKC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|