C23H25NO3 — CID 22948480
N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide (PubChem CID 22948480) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 22948480 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide |
| SMILES | Cc1ccc(OCCCCNC(=O)c2ccc3ccccc3c2O)c(C)c1 |
| InChI | InChI=1S/C23H25NO3/c1-16-9-12-21(17(2)15-16)27-14-6-5-13-24-23(26)20-11-10-18-7-3-4-8-19(18)22(20)25/h3-4,7-12,15,25H,5-6,13-14H2,1-2H3,(H,24,26) |
| InChIKey | NFAJZPPPQJEVSA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|