C29H35NO4 — CID 58658276
4-cyclohexyloxy-N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide (PubChem CID 58658276) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | 4-cyclohexyloxy-N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58658276 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 4-cyclohexyloxy-N-[4-(2,4-dimethylphenoxy)butyl]-1-hydroxynaphthalene-2-carboxamide |
| SMILES | Cc1ccc(OCCCCNC(=O)c2cc(OC3CCCCC3)c3ccccc3c2O)c(C)c1 |
| InChI | InChI=1S/C29H35NO4/c1-20-14-15-26(21(2)18-20)33-17-9-8-16-30-29(32)25-19-27(34-22-10-4-3-5-11-22)23-12-6-7-13-24(23)28(25)31/h6-7,12-15,18-19,22,31H,3-5,8-11,16-17H2,1-2H3,(H,30,32) |
| InChIKey | YECNMAIUUXMZIU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|