C32H32N2O6 — CID 22095856
4-[4-[3-(2,4-dimethylphenoxy)propylcarbamoyl]phenoxy]-N-ethyl-5-formyl-1-hydroxynaphthalene-2-carboxamide (PubChem CID 22095856) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4-[4-[3-(2,4-dimethylphenoxy)propylcarbamoyl]phenoxy]-N-ethyl-5-formyl-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | 4-[4-[3-(2,4-dimethylphenoxy)propylcarbamoyl]phenoxy]-N-ethyl-5-formyl-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 22095856 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 4-[4-[3-(2,4-dimethylphenoxy)propylcarbamoyl]phenoxy]-N-ethyl-5-formyl-1-hydroxynaphthalene-2-carboxamide |
| SMILES | CCNC(=O)c1cc(Oc2ccc(C(=O)NCCCOc3ccc(C)cc3C)cc2)c2c(C=O)cccc2c1O |
| InChI | InChI=1S/C32H32N2O6/c1-4-33-32(38)26-18-28(29-23(19-35)7-5-8-25(29)30(26)36)40-24-12-10-22(11-13-24)31(37)34-15-6-16-39-27-14-9-20(2)17-21(27)3/h5,7-14,17-19,36H,4,6,15-16H2,1-3H3,(H,33,38)(H,34,37) |
| InChIKey | GLWAGZNVLDIHQW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|