C17H19NO2 — CID 12941864
3-(2,4-dimethylphenoxy)-N-ethylbenzamide (PubChem CID 12941864) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(2,4-dimethylphenoxy)-N-ethylbenzamide.
| Compound Name | 3-(2,4-dimethylphenoxy)-N-ethylbenzamide |
|---|---|
| PubChem CID | 12941864 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(2,4-dimethylphenoxy)-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(Oc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C17H19NO2/c1-4-18-17(19)14-6-5-7-15(11-14)20-16-9-8-12(2)10-13(16)3/h5-11H,4H2,1-3H3,(H,18,19) |
| InChIKey | HVSUVYGDQOVOMA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |