About ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene
ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene (PubChem CID 142892736) has the molecular formula C19H26FNO
and a molecular weight of 303.42 g/mol. Its IUPAC name is ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene.
Molecular Properties
| Compound Name | ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene |
| PubChem CID | 142892736 |
| Molecular Formula | C19H26FNO |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene |
| SMILES | CC.CCNC(=O)c1cccc(C)c1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C10H13NO.C7H7F.C2H6/c1-3-11-10(12)9-6-4-5-8(2)7-9;1-6-3-2-4-7(8)5-6;1-2/h4-7H,3H2,1-2H3,(H,11,12);2-5H,1H3;1-2H3 |
| InChIKey | UNJWPAWVKDBHAF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene?
The IUPAC name of ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene (CID 142892736) is ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene.
What is the SMILES notation for ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene?
The canonical SMILES for ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene is CC.CCNC(=O)c1cccc(C)c1.Cc1cccc(F)c1.
What is the InChIKey of ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene?
The InChIKey is UNJWPAWVKDBHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.C7H7F.C2H6/c1-3-11-10(12)9-6-4-5-8(2)7-9;1-6-3-2-4-7(8)5-6;1-2/h4-7H,3H2,1-2H3,(H,11,12);2-5H,1H3;1-2H3.
What are the key properties of ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene?
ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene has a molecular weight of 303.42 g/mol, XLogP of 4.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-3-methylbenzamide;1-fluoro-3-methylbenzene is sourced from PubChem (CID 142892736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).