C11H14N2OS — CID 4947765
N-(ethylcarbamothioyl)-3-methylbenzamide (PubChem CID 4947765) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(ethylcarbamothioyl)-3-methylbenzamide.
| Compound Name | N-(ethylcarbamothioyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 4947765 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(ethylcarbamothioyl)-3-methylbenzamide |
| SMILES | CCNC(=S)NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C11H14N2OS/c1-3-12-11(15)13-10(14)9-6-4-5-8(2)7-9/h4-7H,3H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | ZLHVDUKFPGJAHP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|