C16H13N3OS — CID 905209
N-[(2-cyanophenyl)carbamothioyl]-3-methylbenzamide (PubChem CID 905209) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is N-[(2-cyanophenyl)carbamothioyl]-3-methylbenzamide.
| Compound Name | N-[(2-cyanophenyl)carbamothioyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 905209 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[(2-cyanophenyl)carbamothioyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(=S)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C16H13N3OS/c1-11-5-4-7-12(9-11)15(20)19-16(21)18-14-8-3-2-6-13(14)10-17/h2-9H,1H3,(H2,18,19,20,21) |
| InChIKey | XHAGALMHJPVPFG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|