C17H18N2O2S — CID 7325861
N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]-3-methylbenzamide (PubChem CID 7325861) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]-3-methylbenzamide.
| Compound Name | N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 7325861 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[(2-hydroxy-4,5-dimethylphenyl)carbamothioyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(=S)Nc2cc(C)c(C)cc2O)c1 |
| InChI | InChI=1S/C17H18N2O2S/c1-10-5-4-6-13(7-10)16(21)19-17(22)18-14-8-11(2)12(3)9-15(14)20/h4-9,20H,1-3H3,(H2,18,19,21,22) |
| InChIKey | CXRUEFDAKWPKKD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|