C21H17N3O2S — CID 3938599
N-[(2-cyanophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide (PubChem CID 3938599) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[(2-cyanophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N-[(2-cyanophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3938599 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-[(2-cyanophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3ccccc3C#N)o2)cc1C |
| InChI | InChI=1S/C21H17N3O2S/c1-13-7-8-15(11-14(13)2)18-9-10-19(26-18)20(25)24-21(27)23-17-6-4-3-5-16(17)12-22/h3-11H,1-2H3,(H2,23,24,25,27) |
| InChIKey | LWNFXKUMYAKCJS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|