C23H22N2O4S — CID 3371575
ethyl 4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoate (PubChem CID 3371575) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is ethyl 4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 3371575 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | ethyl 4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC(=O)c2ccc(-c3ccc(C)c(C)c3)o2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c1-4-28-22(27)16-7-9-18(10-8-16)24-23(30)25-21(26)20-12-11-19(29-20)17-6-5-14(2)15(3)13-17/h5-13H,4H2,1-3H3,(H2,24,25,26,30) |
| InChIKey | VRGPNSBJYUWNHM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|