C21H17ClN2O4S — CID 3251427
2-chloro-4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoic acid (PubChem CID 3251427) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 2-chloro-4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3251427 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 2-chloro-4-[[5-(3,4-dimethylphenyl)furan-2-carbonyl]carbamothioylamino]benzoic acid |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3ccc(C(=O)O)c(Cl)c3)o2)cc1C |
| InChI | InChI=1S/C21H17ClN2O4S/c1-11-3-4-13(9-12(11)2)17-7-8-18(28-17)19(25)24-21(29)23-14-5-6-15(20(26)27)16(22)10-14/h3-10H,1-2H3,(H,26,27)(H2,23,24,25,29) |
| InChIKey | SZHXHNFERVVMFA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|