C20H17FN2O2S — CID 3450386
5-(3,4-dimethylphenyl)-N-[(3-fluorophenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 3450386) has the molecular formula C20H17FN2O2S and a molecular weight of 368.43 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[(3-fluorophenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[(3-fluorophenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3450386 |
| Molecular Formula | C20H17FN2O2S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[(3-fluorophenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3cccc(F)c3)o2)cc1C |
| InChI | InChI=1S/C20H17FN2O2S/c1-12-6-7-14(10-13(12)2)17-8-9-18(25-17)19(24)23-20(26)22-16-5-3-4-15(21)11-16/h3-11H,1-2H3,(H2,22,23,24,26) |
| InChIKey | UFVKVFURUDPYOA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|