C20H15BrF2N2O2S — CID 5039056
N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide (PubChem CID 5039056) has the molecular formula C20H15BrF2N2O2S and a molecular weight of 465.32 g/mol. Its IUPAC name is N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5039056 |
| Molecular Formula | C20H15BrF2N2O2S |
| Molecular Weight | 465.32 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3c(F)cc(F)cc3Br)o2)cc1C |
| InChI | InChI=1S/C20H15BrF2N2O2S/c1-10-3-4-12(7-11(10)2)16-5-6-17(27-16)19(26)25-20(28)24-18-14(21)8-13(22)9-15(18)23/h3-9H,1-2H3,(H2,24,25,26,28) |
| InChIKey | MOUAPYJJTXNKHJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.32 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|