C27H21N3O2S2 — CID 4211759
N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide (PubChem CID 4211759) has the molecular formula C27H21N3O2S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4211759 |
| Molecular Formula | C27H21N3O2S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3cccc(-c4nc5ccccc5s4)c3)o2)cc1C |
| InChI | InChI=1S/C27H21N3O2S2/c1-16-10-11-18(14-17(16)2)22-12-13-23(32-22)25(31)30-27(33)28-20-7-5-6-19(15-20)26-29-21-8-3-4-9-24(21)34-26/h3-15H,1-2H3,(H2,28,30,31,33) |
| InChIKey | QHLXUORMKGSUMN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|