C25H15BrClN3O2S2 — CID 17316302
N-[[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]carbamothioyl]-5-(4-bromophenyl)furan-2-carboxamide (PubChem CID 17316302) has the molecular formula C25H15BrClN3O2S2 and a molecular weight of 568.91 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]carbamothioyl]-5-(4-bromophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]carbamothioyl]-5-(4-bromophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17316302 |
| Molecular Formula | C25H15BrClN3O2S2 |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 566.95 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]carbamothioyl]-5-(4-bromophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(-c2nc3ccccc3s2)c(Cl)c1)c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C25H15BrClN3O2S2/c26-15-7-5-14(6-8-15)20-11-12-21(32-20)23(31)30-25(33)28-16-9-10-17(18(27)13-16)24-29-19-3-1-2-4-22(19)34-24/h1-13H,(H2,28,30,31,33) |
| InChIKey | AEVNLLJKHLDHHA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|