C30H24N2O4S — CID 3914556
5-(3,4-dimethylphenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 3914556) has the molecular formula C30H24N2O4S and a molecular weight of 508.60 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3914556 |
| Molecular Formula | C30H24N2O4S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3cc(-c4cc5ccccc5oc4=O)ccc3C)o2)cc1C |
| InChI | InChI=1S/C30H24N2O4S/c1-17-8-11-22(14-19(17)3)26-12-13-27(35-26)28(33)32-30(37)31-24-16-20(10-9-18(24)2)23-15-21-6-4-5-7-25(21)36-29(23)34/h4-16H,1-3H3,(H2,31,32,33,37) |
| InChIKey | YQJQJECGZJDJLS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|