C25H19ClN2O3S — CID 2231738
2-chloro-4-methyl-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide (PubChem CID 2231738) has the molecular formula C25H19ClN2O3S and a molecular weight of 462.96 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2231738 |
| Molecular Formula | C25H19ClN2O3S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 2-chloro-4-methyl-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(-c3cc4ccccc4oc3=O)ccc2C)c(Cl)c1 |
| InChI | InChI=1S/C25H19ClN2O3S/c1-14-7-10-18(20(26)11-14)23(29)28-25(32)27-21-13-16(9-8-15(21)2)19-12-17-5-3-4-6-22(17)31-24(19)30/h3-13H,1-2H3,(H2,27,28,29,32) |
| InChIKey | QCJXQKLSSCAFKY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|