C28H26N2O4S — CID 17112234
N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide (PubChem CID 17112234) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17112234 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide |
| SMILES | Cc1ccc(-c2cc3ccccc3oc2=O)cc1NC(=S)NC(=O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C28H26N2O4S/c1-17(2)16-33-22-12-10-19(11-13-22)26(31)30-28(35)29-24-15-20(9-8-18(24)3)23-14-21-6-4-5-7-25(21)34-27(23)32/h4-15,17H,16H2,1-3H3,(H2,29,30,31,35) |
| InChIKey | MLVPOMOJJTZGAK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|